C18H17N5OS3 — CID 19722117
7-[[4-methyl-5-(4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-1,2,4-triazol-3-yl]sulfanylmethyl]-[1,3]thiazolo[3,2-a]pyrimidin-5-one (PubChem CID 19722117) has the molecular formula C18H17N5OS3 and a molecular weight of 415.57 g/mol. Its IUPAC name is 7-[[4-methyl-5-(4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-1,2,4-triazol-3-yl]sulfanylmethyl]-[1,3]thiazolo[3,2-a]pyrimidin-5-one.
| Compound Name | 7-[[4-methyl-5-(4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-1,2,4-triazol-3-yl]sulfanylmethyl]-[1,3]thiazolo[3,2-a]pyrimidin-5-one |
|---|---|
| PubChem CID | 19722117 |
| Molecular Formula | C18H17N5OS3 |
| Molecular Weight | 415.57 g/mol |
| Exact Mass | 415.06 |
| IUPAC Name | 7-[[4-methyl-5-(4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-1,2,4-triazol-3-yl]sulfanylmethyl]-[1,3]thiazolo[3,2-a]pyrimidin-5-one |
| SMILES | Cn1c(SCc2cc(=O)n3ccsc3n2)nnc1-c1csc2c1CCCC2 |
| InChI | InChI=1S/C18H17N5OS3/c1-22-16(13-10-26-14-5-3-2-4-12(13)14)20-21-18(22)27-9-11-8-15(24)23-6-7-25-17(23)19-11/h6-8,10H,2-5,9H2,1H3 |
| InChIKey | JBSZNWNPZZPPGI-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 65.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.57 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |