C14H12N6OS2 — CID 42960234
7-[(5,7-dimethyl-[1,2,4]triazolo[4,3-c]pyrimidin-3-yl)sulfanylmethyl]-[1,3]thiazolo[3,2-a]pyrimidin-5-one (PubChem CID 42960234) has the molecular formula C14H12N6OS2 and a molecular weight of 344.43 g/mol. Its IUPAC name is 7-[(5,7-dimethyl-[1,2,4]triazolo[4,3-c]pyrimidin-3-yl)sulfanylmethyl]-[1,3]thiazolo[3,2-a]pyrimidin-5-one.
| Compound Name | 7-[(5,7-dimethyl-[1,2,4]triazolo[4,3-c]pyrimidin-3-yl)sulfanylmethyl]-[1,3]thiazolo[3,2-a]pyrimidin-5-one |
|---|---|
| PubChem CID | 42960234 |
| Molecular Formula | C14H12N6OS2 |
| Molecular Weight | 344.43 g/mol |
| Exact Mass | 344.05 |
| IUPAC Name | 7-[(5,7-dimethyl-[1,2,4]triazolo[4,3-c]pyrimidin-3-yl)sulfanylmethyl]-[1,3]thiazolo[3,2-a]pyrimidin-5-one |
| SMILES | Cc1cc2nnc(SCc3cc(=O)n4ccsc4n3)n2c(C)n1 |
| InChI | InChI=1S/C14H12N6OS2/c1-8-5-11-17-18-14(20(11)9(2)15-8)23-7-10-6-12(21)19-3-4-22-13(19)16-10/h3-6H,7H2,1-2H3 |
| InChIKey | AQHAKGDGPWHRJS-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 77.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.43 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |