C25H28N4O5S2 — CID 19722553
dimethyl 5-[[2-[[4-propan-2-yl-5-(4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]benzene-1,3-dicarboxylate (PubChem CID 19722553) has the molecular formula C25H28N4O5S2 and a molecular weight of 528.66 g/mol. Its IUPAC name is dimethyl 5-[[2-[[4-propan-2-yl-5-(4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-[[2-[[4-propan-2-yl-5-(4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 19722553 |
| Molecular Formula | C25H28N4O5S2 |
| Molecular Weight | 528.66 g/mol |
| Exact Mass | 528.15 |
| IUPAC Name | dimethyl 5-[[2-[[4-propan-2-yl-5-(4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]benzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(NC(=O)CSc2nnc(-c3csc4c3CCCC4)n2C(C)C)cc(C(=O)OC)c1 |
| InChI | InChI=1S/C25H28N4O5S2/c1-14(2)29-22(19-12-35-20-8-6-5-7-18(19)20)27-28-25(29)36-13-21(30)26-17-10-15(23(31)33-3)9-16(11-17)24(32)34-4/h9-12,14H,5-8,13H2,1-4H3,(H,26,30) |
| InChIKey | WHTROJZEDIUJGA-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 112.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.66 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |