C26H29N5OS3 — CID 19722480
N-[4-(3,4-dimethylphenyl)-1,3-thiazol-2-yl]-2-[[4-propan-2-yl-5-(4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 19722480) has the molecular formula C26H29N5OS3 and a molecular weight of 523.75 g/mol. Its IUPAC name is N-[4-(3,4-dimethylphenyl)-1,3-thiazol-2-yl]-2-[[4-propan-2-yl-5-(4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-[4-(3,4-dimethylphenyl)-1,3-thiazol-2-yl]-2-[[4-propan-2-yl-5-(4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 19722480 |
| Molecular Formula | C26H29N5OS3 |
| Molecular Weight | 523.75 g/mol |
| Exact Mass | 523.15 |
| IUPAC Name | N-[4-(3,4-dimethylphenyl)-1,3-thiazol-2-yl]-2-[[4-propan-2-yl-5-(4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | Cc1ccc(-c2csc(NC(=O)CSc3nnc(-c4csc5c4CCCC5)n3C(C)C)n2)cc1C |
| InChI | InChI=1S/C26H29N5OS3/c1-15(2)31-24(20-12-33-22-8-6-5-7-19(20)22)29-30-26(31)35-14-23(32)28-25-27-21(13-34-25)18-10-9-16(3)17(4)11-18/h9-13,15H,5-8,14H2,1-4H3,(H,27,28,32) |
| InChIKey | IIESMEISXZYOSN-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.75 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |