C11H10Cl2N2S — CID 19727760
2-[(2,6-dichlorophenyl)methylsulfanyl]-1-methylimidazole (PubChem CID 19727760) has the molecular formula C11H10Cl2N2S and a molecular weight of 273.19 g/mol. Its IUPAC name is 2-[(2,6-dichlorophenyl)methylsulfanyl]-1-methylimidazole.
| Compound Name | 2-[(2,6-dichlorophenyl)methylsulfanyl]-1-methylimidazole |
|---|---|
| PubChem CID | 19727760 |
| Molecular Formula | C11H10Cl2N2S |
| Molecular Weight | 273.19 g/mol |
| Exact Mass | 271.99 |
| IUPAC Name | 2-[(2,6-dichlorophenyl)methylsulfanyl]-1-methylimidazole |
| SMILES | Cn1ccnc1SCc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C11H10Cl2N2S/c1-15-6-5-14-11(15)16-7-8-9(12)3-2-4-10(8)13/h2-6H,7H2,1H3 |
| InChIKey | BVTXWFPENBUQQF-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.19 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |