C17H13Cl3N2S — CID 2747525
5-(4-chlorophenyl)-2-[(2,6-dichlorophenyl)methylsulfanyl]-1-methylimidazole (PubChem CID 2747525) has the molecular formula C17H13Cl3N2S and a molecular weight of 383.73 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-2-[(2,6-dichlorophenyl)methylsulfanyl]-1-methylimidazole.
| Compound Name | 5-(4-chlorophenyl)-2-[(2,6-dichlorophenyl)methylsulfanyl]-1-methylimidazole |
|---|---|
| PubChem CID | 2747525 |
| Molecular Formula | C17H13Cl3N2S |
| Molecular Weight | 383.73 g/mol |
| Exact Mass | 381.99 |
| IUPAC Name | 5-(4-chlorophenyl)-2-[(2,6-dichlorophenyl)methylsulfanyl]-1-methylimidazole |
| SMILES | Cn1c(-c2ccc(Cl)cc2)cnc1SCc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C17H13Cl3N2S/c1-22-16(11-5-7-12(18)8-6-11)9-21-17(22)23-10-13-14(19)3-2-4-15(13)20/h2-9H,10H2,1H3 |
| InChIKey | GEOBXHFLZAYHDD-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.73 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het_thio_5_A(8)', 'substructure': 'N/A'} |
|---|