About ethyl 3-chloro-4-oxoheptanoate
ethyl 3-chloro-4-oxoheptanoate (PubChem CID 19735617) has the molecular formula C9H15ClO3
and a molecular weight of 206.67 g/mol. Its IUPAC name is ethyl 3-chloro-4-oxoheptanoate.
Molecular Properties
| Compound Name | ethyl 3-chloro-4-oxoheptanoate |
| PubChem CID | 19735617 |
| Molecular Formula | C9H15ClO3 |
| Molecular Weight | 206.67 g/mol |
| Exact Mass | 206.07 |
| IUPAC Name | ethyl 3-chloro-4-oxoheptanoate |
| SMILES | CCCC(=O)C(Cl)CC(=O)OCC |
| InChI | InChI=1S/C9H15ClO3/c1-3-5-8(11)7(10)6-9(12)13-4-2/h7H,3-6H2,1-2H3 |
| InChIKey | TVXCWBRAKLMEMC-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.67 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze ethyl 3-chloro-4-oxoheptanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-chloro-4-oxoheptanoate?
The IUPAC name of ethyl 3-chloro-4-oxoheptanoate (CID 19735617) is ethyl 3-chloro-4-oxoheptanoate.
What is the SMILES notation for ethyl 3-chloro-4-oxoheptanoate?
The canonical SMILES for ethyl 3-chloro-4-oxoheptanoate is CCCC(=O)C(Cl)CC(=O)OCC.
What is the InChIKey of ethyl 3-chloro-4-oxoheptanoate?
The InChIKey is TVXCWBRAKLMEMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15ClO3/c1-3-5-8(11)7(10)6-9(12)13-4-2/h7H,3-6H2,1-2H3.
What are the key properties of ethyl 3-chloro-4-oxoheptanoate?
ethyl 3-chloro-4-oxoheptanoate has a molecular weight of 206.67 g/mol, XLogP of 1.92, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-chloro-4-oxoheptanoate is sourced from PubChem (CID 19735617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).