C18H18Cl4 — CID 19736782
1,3-dichloro-5-[2-(3,5-dichlorophenyl)hexan-2-yl]benzene (PubChem CID 19736782) has the molecular formula C18H18Cl4 and a molecular weight of 376.15 g/mol. Its IUPAC name is 1,3-dichloro-5-[2-(3,5-dichlorophenyl)hexan-2-yl]benzene.
| Compound Name | 1,3-dichloro-5-[2-(3,5-dichlorophenyl)hexan-2-yl]benzene |
|---|---|
| PubChem CID | 19736782 |
| Molecular Formula | C18H18Cl4 |
| Molecular Weight | 376.15 g/mol |
| Exact Mass | 374.02 |
| IUPAC Name | 1,3-dichloro-5-[2-(3,5-dichlorophenyl)hexan-2-yl]benzene |
| SMILES | CCCCC(C)(c1cc(Cl)cc(Cl)c1)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C18H18Cl4/c1-3-4-5-18(2,12-6-14(19)10-15(20)7-12)13-8-16(21)11-17(22)9-13/h6-11H,3-5H2,1-2H3 |
| InChIKey | NYDXXAFFAXTCMD-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.15 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |