C16H14FN3O4 — CID 19737150
2-cyano-5-(3,4-diethyl-2,6-dioxopyrimidin-1-yl)-4-fluorobenzoic acid (PubChem CID 19737150) has the molecular formula C16H14FN3O4 and a molecular weight of 331.30 g/mol. Its IUPAC name is 2-cyano-5-(3,4-diethyl-2,6-dioxopyrimidin-1-yl)-4-fluorobenzoic acid.
| Compound Name | 2-cyano-5-(3,4-diethyl-2,6-dioxopyrimidin-1-yl)-4-fluorobenzoic acid |
|---|---|
| PubChem CID | 19737150 |
| Molecular Formula | C16H14FN3O4 |
| Molecular Weight | 331.30 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | 2-cyano-5-(3,4-diethyl-2,6-dioxopyrimidin-1-yl)-4-fluorobenzoic acid |
| SMILES | CCc1cc(=O)n(-c2cc(C(=O)O)c(C#N)cc2F)c(=O)n1CC |
| InChI | InChI=1S/C16H14FN3O4/c1-3-10-6-14(21)20(16(24)19(10)4-2)13-7-11(15(22)23)9(8-18)5-12(13)17/h5-7H,3-4H2,1-2H3,(H,22,23) |
| InChIKey | RCKCAZOSJDLJFJ-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.30 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |