C14H10FN3O4 — CID 19737168
2-cyano-5-(6-ethyl-2,4-dioxo-1H-pyrimidin-3-yl)-4-fluorobenzoic acid (PubChem CID 19737168) has the molecular formula C14H10FN3O4 and a molecular weight of 303.25 g/mol. Its IUPAC name is 2-cyano-5-(6-ethyl-2,4-dioxo-1H-pyrimidin-3-yl)-4-fluorobenzoic acid.
| Compound Name | 2-cyano-5-(6-ethyl-2,4-dioxo-1H-pyrimidin-3-yl)-4-fluorobenzoic acid |
|---|---|
| PubChem CID | 19737168 |
| Molecular Formula | C14H10FN3O4 |
| Molecular Weight | 303.25 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | 2-cyano-5-(6-ethyl-2,4-dioxo-1H-pyrimidin-3-yl)-4-fluorobenzoic acid |
| SMILES | CCc1cc(=O)n(-c2cc(C(=O)O)c(C#N)cc2F)c(=O)[nH]1 |
| InChI | InChI=1S/C14H10FN3O4/c1-2-8-4-12(19)18(14(22)17-8)11-5-9(13(20)21)7(6-16)3-10(11)15/h3-5H,2H2,1H3,(H,17,22)(H,20,21) |
| InChIKey | YGGHIDOHLMIYOM-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 115.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.25 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |