About 7-hydroxy-2-oxoheptanal
7-hydroxy-2-oxoheptanal (PubChem CID 19737750) has the molecular formula C7H12O3
and a molecular weight of 144.17 g/mol. Its IUPAC name is 7-hydroxy-2-oxoheptanal.
Molecular Properties
| Compound Name | 7-hydroxy-2-oxoheptanal |
| PubChem CID | 19737750 |
| Molecular Formula | C7H12O3 |
| Molecular Weight | 144.17 g/mol |
| Exact Mass | 144.08 |
| IUPAC Name | 7-hydroxy-2-oxoheptanal |
| SMILES | O=CC(=O)CCCCCO |
| InChI | InChI=1S/C7H12O3/c8-5-3-1-2-4-7(10)6-9/h6,8H,1-5H2 |
| InChIKey | LHNKIZAXFUBZSW-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.17 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 7-hydroxy-2-oxoheptanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-hydroxy-2-oxoheptanal?
The IUPAC name of 7-hydroxy-2-oxoheptanal (CID 19737750) is 7-hydroxy-2-oxoheptanal.
What is the SMILES notation for 7-hydroxy-2-oxoheptanal?
The canonical SMILES for 7-hydroxy-2-oxoheptanal is O=CC(=O)CCCCCO.
What is the InChIKey of 7-hydroxy-2-oxoheptanal?
The InChIKey is LHNKIZAXFUBZSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O3/c8-5-3-1-2-4-7(10)6-9/h6,8H,1-5H2.
What are the key properties of 7-hydroxy-2-oxoheptanal?
7-hydroxy-2-oxoheptanal has a molecular weight of 144.17 g/mol, XLogP of 0.31, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-hydroxy-2-oxoheptanal is sourced from PubChem (CID 19737750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).