14-(2,3-dihydroxypropoxycarbonyl)pentadec-14-enoic acid

C19H34O6 — CID 19743156

IUPAC14-(2,3-dihydroxypropoxycarbonyl)pentadec-14-enoic acid
SMILESC=C(CCCCCCCCCCCCC(=O)O)C(=O)OCC(O)CO
InChIInChI=1S/C19H34O6/c1-16(19(24)25-15-17(21)14-20)12-10-8-6-4-2-3-5-7-9-11-13-18(22)23/h17,20-21H,1-15H2,(H,22,23)
InChIKeyAGIBUWMUZTZRQD-UHFFFAOYSA-N
MW358.48 g/mol
LogP3.20
Rot. Bonds17

About 14-(2,3-dihydroxypropoxycarbonyl)pentadec-14-enoic acid

14-(2,3-dihydroxypropoxycarbonyl)pentadec-14-enoic acid (PubChem CID 19743156) has the molecular formula C19H34O6 and a molecular weight of 358.48 g/mol. Its IUPAC name is 14-(2,3-dihydroxypropoxycarbonyl)pentadec-14-enoic acid.

Molecular Properties

Compound Name14-(2,3-dihydroxypropoxycarbonyl)pentadec-14-enoic acid
PubChem CID19743156
Molecular FormulaC19H34O6
Molecular Weight358.48 g/mol
Exact Mass358.24
IUPAC Name14-(2,3-dihydroxypropoxycarbonyl)pentadec-14-enoic acid
SMILESC=C(CCCCCCCCCCCCC(=O)O)C(=O)OCC(O)CO
InChIInChI=1S/C19H34O6/c1-16(19(24)25-15-17(21)14-20)12-10-8-6-4-2-3-5-7-9-11-13-18(22)23/h17,20-21H,1-15H2,(H,22,23)
InChIKeyAGIBUWMUZTZRQD-UHFFFAOYSA-N
XLogP3.20
TPSA104.06 Ų
H-Bond Donors3
H-Bond Acceptors5
Rotatable Bonds17
Heavy Atoms25
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500358.48
LogP ≤ 53.20
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 14-(2,3-dihydroxypropoxycarbonyl)pentadec-14-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 14-(2,3-dihydroxypropoxycarbonyl)pentadec-14-enoic acid?
The IUPAC name of 14-(2,3-dihydroxypropoxycarbonyl)pentadec-14-enoic acid (CID 19743156) is 14-(2,3-dihydroxypropoxycarbonyl)pentadec-14-enoic acid.
What is the SMILES notation for 14-(2,3-dihydroxypropoxycarbonyl)pentadec-14-enoic acid?
The canonical SMILES for 14-(2,3-dihydroxypropoxycarbonyl)pentadec-14-enoic acid is C=C(CCCCCCCCCCCCC(=O)O)C(=O)OCC(O)CO.
What is the InChIKey of 14-(2,3-dihydroxypropoxycarbonyl)pentadec-14-enoic acid?
The InChIKey is AGIBUWMUZTZRQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H34O6/c1-16(19(24)25-15-17(21)14-20)12-10-8-6-4-2-3-5-7-9-11-13-18(22)23/h17,20-21H,1-15H2,(H,22,23).
What are the key properties of 14-(2,3-dihydroxypropoxycarbonyl)pentadec-14-enoic acid?
14-(2,3-dihydroxypropoxycarbonyl)pentadec-14-enoic acid has a molecular weight of 358.48 g/mol, XLogP of 3.20, 17 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 14-(2,3-dihydroxypropoxycarbonyl)pentadec-14-enoic acid is sourced from PubChem (CID 19743156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).