C19H34O6 — CID 19743156
14-(2,3-dihydroxypropoxycarbonyl)pentadec-14-enoic acid (PubChem CID 19743156) has the molecular formula C19H34O6 and a molecular weight of 358.48 g/mol. Its IUPAC name is 14-(2,3-dihydroxypropoxycarbonyl)pentadec-14-enoic acid.
| Compound Name | 14-(2,3-dihydroxypropoxycarbonyl)pentadec-14-enoic acid |
|---|---|
| PubChem CID | 19743156 |
| Molecular Formula | C19H34O6 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.24 |
| IUPAC Name | 14-(2,3-dihydroxypropoxycarbonyl)pentadec-14-enoic acid |
| SMILES | C=C(CCCCCCCCCCCCC(=O)O)C(=O)OCC(O)CO |
| InChI | InChI=1S/C19H34O6/c1-16(19(24)25-15-17(21)14-20)12-10-8-6-4-2-3-5-7-9-11-13-18(22)23/h17,20-21H,1-15H2,(H,22,23) |
| InChIKey | AGIBUWMUZTZRQD-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|