About 1-benzyl-4-methyl-2,3-dihydro-1λ5-phosphole 1-oxide
1-benzyl-4-methyl-2,3-dihydro-1λ5-phosphole 1-oxide (PubChem CID 19744907) has the molecular formula C12H15OP
and a molecular weight of 206.23 g/mol. Its IUPAC name is 1-benzyl-4-methyl-2,3-dihydro-1λ5-phosphole 1-oxide.
Molecular Properties
| Compound Name | 1-benzyl-4-methyl-2,3-dihydro-1λ5-phosphole 1-oxide |
| PubChem CID | 19744907 |
| Molecular Formula | C12H15OP |
| Molecular Weight | 206.23 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | 1-benzyl-4-methyl-2,3-dihydro-1λ5-phosphole 1-oxide |
| SMILES | CC1=CP(=O)(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C12H15OP/c1-11-7-8-14(13,9-11)10-12-5-3-2-4-6-12/h2-6,9H,7-8,10H2,1H3 |
| InChIKey | HOSWFGMPYWBJMK-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.23 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1-benzyl-4-methyl-2,3-dihydro-1λ5-phosphole 1-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-4-methyl-2,3-dihydro-1λ5-phosphole 1-oxide?
The IUPAC name of 1-benzyl-4-methyl-2,3-dihydro-1λ5-phosphole 1-oxide (CID 19744907) is 1-benzyl-4-methyl-2,3-dihydro-1λ5-phosphole 1-oxide.
What is the SMILES notation for 1-benzyl-4-methyl-2,3-dihydro-1λ5-phosphole 1-oxide?
The canonical SMILES for 1-benzyl-4-methyl-2,3-dihydro-1λ5-phosphole 1-oxide is CC1=CP(=O)(Cc2ccccc2)CC1.
What is the InChIKey of 1-benzyl-4-methyl-2,3-dihydro-1λ5-phosphole 1-oxide?
The InChIKey is HOSWFGMPYWBJMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15OP/c1-11-7-8-14(13,9-11)10-12-5-3-2-4-6-12/h2-6,9H,7-8,10H2,1H3.
What are the key properties of 1-benzyl-4-methyl-2,3-dihydro-1λ5-phosphole 1-oxide?
1-benzyl-4-methyl-2,3-dihydro-1λ5-phosphole 1-oxide has a molecular weight of 206.23 g/mol, XLogP of 3.86, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-4-methyl-2,3-dihydro-1λ5-phosphole 1-oxide is sourced from PubChem (CID 19744907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).