C30H31NO4S — CID 19745854
3-[4-(4-methylsulfanylphenyl)-1-[4-(quinolin-2-ylmethoxy)phenyl]butoxy]propanoic acid (PubChem CID 19745854) has the molecular formula C30H31NO4S and a molecular weight of 501.65 g/mol. Its IUPAC name is 3-[4-(4-methylsulfanylphenyl)-1-[4-(quinolin-2-ylmethoxy)phenyl]butoxy]propanoic acid.
| Compound Name | 3-[4-(4-methylsulfanylphenyl)-1-[4-(quinolin-2-ylmethoxy)phenyl]butoxy]propanoic acid |
|---|---|
| PubChem CID | 19745854 |
| Molecular Formula | C30H31NO4S |
| Molecular Weight | 501.65 g/mol |
| Exact Mass | 501.20 |
| IUPAC Name | 3-[4-(4-methylsulfanylphenyl)-1-[4-(quinolin-2-ylmethoxy)phenyl]butoxy]propanoic acid |
| SMILES | CSc1ccc(CCCC(OCCC(=O)O)c2ccc(OCc3ccc4ccccc4n3)cc2)cc1 |
| InChI | InChI=1S/C30H31NO4S/c1-36-27-17-9-22(10-18-27)5-4-8-29(34-20-19-30(32)33)24-12-15-26(16-13-24)35-21-25-14-11-23-6-2-3-7-28(23)31-25/h2-3,6-7,9-18,29H,4-5,8,19-21H2,1H3,(H,32,33) |
| InChIKey | MBNBZIUPHWVKLQ-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.65 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |