C29H28ClNO4 — CID 19745868
3-[4-(4-chlorophenyl)-1-[4-(quinolin-2-ylmethoxy)phenyl]butoxy]propanoic acid (PubChem CID 19745868) has the molecular formula C29H28ClNO4 and a molecular weight of 490.00 g/mol. Its IUPAC name is 3-[4-(4-chlorophenyl)-1-[4-(quinolin-2-ylmethoxy)phenyl]butoxy]propanoic acid.
| Compound Name | 3-[4-(4-chlorophenyl)-1-[4-(quinolin-2-ylmethoxy)phenyl]butoxy]propanoic acid |
|---|---|
| PubChem CID | 19745868 |
| Molecular Formula | C29H28ClNO4 |
| Molecular Weight | 490.00 g/mol |
| Exact Mass | 489.17 |
| IUPAC Name | 3-[4-(4-chlorophenyl)-1-[4-(quinolin-2-ylmethoxy)phenyl]butoxy]propanoic acid |
| SMILES | O=C(O)CCOC(CCCc1ccc(Cl)cc1)c1ccc(OCc2ccc3ccccc3n2)cc1 |
| InChI | InChI=1S/C29H28ClNO4/c30-24-13-8-21(9-14-24)4-3-7-28(34-19-18-29(32)33)23-11-16-26(17-12-23)35-20-25-15-10-22-5-1-2-6-27(22)31-25/h1-2,5-6,8-17,28H,3-4,7,18-20H2,(H,32,33) |
| InChIKey | CZDWNFJMAAAZRU-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.00 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |