C12H12N4O — CID 19746180
3-azido-2-hydroxy-1,1-dimethyl-2,3-dihydroindene-5-carbonitrile (PubChem CID 19746180) has the molecular formula C12H12N4O and a molecular weight of 228.25 g/mol. Its IUPAC name is 3-azido-2-hydroxy-1,1-dimethyl-2,3-dihydroindene-5-carbonitrile.
| Compound Name | 3-azido-2-hydroxy-1,1-dimethyl-2,3-dihydroindene-5-carbonitrile |
|---|---|
| PubChem CID | 19746180 |
| Molecular Formula | C12H12N4O |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | 3-azido-2-hydroxy-1,1-dimethyl-2,3-dihydroindene-5-carbonitrile |
| SMILES | CC1(C)c2ccc(C#N)cc2C(N=[N+]=[N-])C1O |
| InChI | InChI=1S/C12H12N4O/c1-12(2)9-4-3-7(6-13)5-8(9)10(11(12)17)15-16-14/h3-5,10-11,17H,1-2H3 |
| InChIKey | ZLUJMKMILGPBQX-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|