2,3-di(propan-2-yloxy)propoxymethyl acetate

C12H24O5 — CID 19748423

IUPAC2,3-di(propan-2-yloxy)propoxymethyl acetate
SMILESCC(=O)OCOCC(COC(C)C)OC(C)C
InChIInChI=1S/C12H24O5/c1-9(2)15-7-12(17-10(3)4)6-14-8-16-11(5)13/h9-10,12H,6-8H2,1-5H3
InChIKeyQSYUCWWVESZEJZ-UHFFFAOYSA-N
MW248.32 g/mol
LogP1.74
Rot. Bonds9

About 2,3-di(propan-2-yloxy)propoxymethyl acetate

2,3-di(propan-2-yloxy)propoxymethyl acetate (PubChem CID 19748423) has the molecular formula C12H24O5 and a molecular weight of 248.32 g/mol. Its IUPAC name is 2,3-di(propan-2-yloxy)propoxymethyl acetate.

Molecular Properties

Compound Name2,3-di(propan-2-yloxy)propoxymethyl acetate
PubChem CID19748423
Molecular FormulaC12H24O5
Molecular Weight248.32 g/mol
Exact Mass248.16
IUPAC Name2,3-di(propan-2-yloxy)propoxymethyl acetate
SMILESCC(=O)OCOCC(COC(C)C)OC(C)C
InChIInChI=1S/C12H24O5/c1-9(2)15-7-12(17-10(3)4)6-14-8-16-11(5)13/h9-10,12H,6-8H2,1-5H3
InChIKeyQSYUCWWVESZEJZ-UHFFFAOYSA-N
XLogP1.74
TPSA53.99 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds9
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500248.32
LogP ≤ 51.74
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}

Analyze 2,3-di(propan-2-yloxy)propoxymethyl acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,3-di(propan-2-yloxy)propoxymethyl acetate?
The IUPAC name of 2,3-di(propan-2-yloxy)propoxymethyl acetate (CID 19748423) is 2,3-di(propan-2-yloxy)propoxymethyl acetate.
What is the SMILES notation for 2,3-di(propan-2-yloxy)propoxymethyl acetate?
The canonical SMILES for 2,3-di(propan-2-yloxy)propoxymethyl acetate is CC(=O)OCOCC(COC(C)C)OC(C)C.
What is the InChIKey of 2,3-di(propan-2-yloxy)propoxymethyl acetate?
The InChIKey is QSYUCWWVESZEJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24O5/c1-9(2)15-7-12(17-10(3)4)6-14-8-16-11(5)13/h9-10,12H,6-8H2,1-5H3.
What are the key properties of 2,3-di(propan-2-yloxy)propoxymethyl acetate?
2,3-di(propan-2-yloxy)propoxymethyl acetate has a molecular weight of 248.32 g/mol, XLogP of 1.74, 9 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-di(propan-2-yloxy)propoxymethyl acetate is sourced from PubChem (CID 19748423), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).