C23H32Cl2N4O2 — CID 19749602
2-(2-methoxyphenoxy)-N-[[1-(1-methylbenzimidazol-2-yl)piperidin-4-yl]methyl]ethanamine;dihydrochloride (PubChem CID 19749602) has the molecular formula C23H32Cl2N4O2 and a molecular weight of 467.44 g/mol. Its IUPAC name is 2-(2-methoxyphenoxy)-N-[[1-(1-methylbenzimidazol-2-yl)piperidin-4-yl]methyl]ethanamine;dihydrochloride.
| Compound Name | 2-(2-methoxyphenoxy)-N-[[1-(1-methylbenzimidazol-2-yl)piperidin-4-yl]methyl]ethanamine;dihydrochloride |
|---|---|
| PubChem CID | 19749602 |
| Molecular Formula | C23H32Cl2N4O2 |
| Molecular Weight | 467.44 g/mol |
| Exact Mass | 466.19 |
| IUPAC Name | 2-(2-methoxyphenoxy)-N-[[1-(1-methylbenzimidazol-2-yl)piperidin-4-yl]methyl]ethanamine;dihydrochloride |
| SMILES | COc1ccccc1OCCNCC1CCN(c2nc3ccccc3n2C)CC1.Cl.Cl |
| InChI | InChI=1S/C23H30N4O2.2ClH/c1-26-20-8-4-3-7-19(20)25-23(26)27-14-11-18(12-15-27)17-24-13-16-29-22-10-6-5-9-21(22)28-2;;/h3-10,18,24H,11-17H2,1-2H3;2*1H |
| InChIKey | HGIAVRSPZUHIIS-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 51.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.44 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|