C20H19N3O3 — CID 19750024
2-[4-[(2-but-3-enyl-5-oxo-1H-1,2,4-triazol-3-yl)methyl]phenyl]benzoic acid (PubChem CID 19750024) has the molecular formula C20H19N3O3 and a molecular weight of 349.39 g/mol. Its IUPAC name is 2-[4-[(2-but-3-enyl-5-oxo-1H-1,2,4-triazol-3-yl)methyl]phenyl]benzoic acid.
| Compound Name | 2-[4-[(2-but-3-enyl-5-oxo-1H-1,2,4-triazol-3-yl)methyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 19750024 |
| Molecular Formula | C20H19N3O3 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | 2-[4-[(2-but-3-enyl-5-oxo-1H-1,2,4-triazol-3-yl)methyl]phenyl]benzoic acid |
| SMILES | C=CCCn1[nH]c(=O)nc1Cc1ccc(-c2ccccc2C(=O)O)cc1 |
| InChI | InChI=1S/C20H19N3O3/c1-2-3-12-23-18(21-20(26)22-23)13-14-8-10-15(11-9-14)16-6-4-5-7-17(16)19(24)25/h2,4-11H,1,3,12-13H2,(H,22,26)(H,24,25) |
| InChIKey | WSMXHMCOCBFKCA-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 87.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|