C22H23N3O3 — CID 54427543
2-[4-[(5-but-3-enyl-3-ethoxy-1,2,4-triazol-1-yl)methyl]phenyl]benzoic acid (PubChem CID 54427543) has the molecular formula C22H23N3O3 and a molecular weight of 377.44 g/mol. Its IUPAC name is 2-[4-[(5-but-3-enyl-3-ethoxy-1,2,4-triazol-1-yl)methyl]phenyl]benzoic acid.
| Compound Name | 2-[4-[(5-but-3-enyl-3-ethoxy-1,2,4-triazol-1-yl)methyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 54427543 |
| Molecular Formula | C22H23N3O3 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | 2-[4-[(5-but-3-enyl-3-ethoxy-1,2,4-triazol-1-yl)methyl]phenyl]benzoic acid |
| SMILES | C=CCCc1nc(OCC)nn1Cc1ccc(-c2ccccc2C(=O)O)cc1 |
| InChI | InChI=1S/C22H23N3O3/c1-3-5-10-20-23-22(28-4-2)24-25(20)15-16-11-13-17(14-12-16)18-8-6-7-9-19(18)21(26)27/h3,6-9,11-14H,1,4-5,10,15H2,2H3,(H,26,27) |
| InChIKey | WFEJUGONCKBWLC-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|