C24H26N2O3 — CID 19023938
methyl 2-[4-[(3-but-3-enyl-5-methoxy-4-methylpyrazol-1-yl)methyl]phenyl]benzoate (PubChem CID 19023938) has the molecular formula C24H26N2O3 and a molecular weight of 390.48 g/mol. Its IUPAC name is methyl 2-[4-[(3-but-3-enyl-5-methoxy-4-methylpyrazol-1-yl)methyl]phenyl]benzoate.
| Compound Name | methyl 2-[4-[(3-but-3-enyl-5-methoxy-4-methylpyrazol-1-yl)methyl]phenyl]benzoate |
|---|---|
| PubChem CID | 19023938 |
| Molecular Formula | C24H26N2O3 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | methyl 2-[4-[(3-but-3-enyl-5-methoxy-4-methylpyrazol-1-yl)methyl]phenyl]benzoate |
| SMILES | C=CCCc1nn(Cc2ccc(-c3ccccc3C(=O)OC)cc2)c(OC)c1C |
| InChI | InChI=1S/C24H26N2O3/c1-5-6-11-22-17(2)23(28-3)26(25-22)16-18-12-14-19(15-13-18)20-9-7-8-10-21(20)24(27)29-4/h5,7-10,12-15H,1,6,11,16H2,2-4H3 |
| InChIKey | NXFXUMYUPOWNFI-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|