About N-(2-methoxyethyl)prop-2-enamide;bis(propan-2-one)
N-(2-methoxyethyl)prop-2-enamide;bis(propan-2-one) (PubChem CID 19756748) has the molecular formula C12H23NO4
and a molecular weight of 245.32 g/mol. Its IUPAC name is N-(2-methoxyethyl)prop-2-enamide;bis(propan-2-one).
Molecular Properties
| Compound Name | N-(2-methoxyethyl)prop-2-enamide;bis(propan-2-one) |
| PubChem CID | 19756748 |
| Molecular Formula | C12H23NO4 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.16 |
| IUPAC Name | N-(2-methoxyethyl)prop-2-enamide;bis(propan-2-one) |
| SMILES | C=CC(=O)NCCOC.CC(C)=O.CC(C)=O |
| InChI | InChI=1S/C6H11NO2.2C3H6O/c1-3-6(8)7-4-5-9-2;2*1-3(2)4/h3H,1,4-5H2,2H3,(H,7,8);2*1-2H3 |
| InChIKey | BZMHRUMYWBGIHT-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-(2-methoxyethyl)prop-2-enamide;bis(propan-2-one) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-methoxyethyl)prop-2-enamide;bis(propan-2-one)?
The IUPAC name of N-(2-methoxyethyl)prop-2-enamide;bis(propan-2-one) (CID 19756748) is N-(2-methoxyethyl)prop-2-enamide;bis(propan-2-one).
What is the SMILES notation for N-(2-methoxyethyl)prop-2-enamide;bis(propan-2-one)?
The canonical SMILES for N-(2-methoxyethyl)prop-2-enamide;bis(propan-2-one) is C=CC(=O)NCCOC.CC(C)=O.CC(C)=O.
What is the InChIKey of N-(2-methoxyethyl)prop-2-enamide;bis(propan-2-one)?
The InChIKey is BZMHRUMYWBGIHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO2.2C3H6O/c1-3-6(8)7-4-5-9-2;2*1-3(2)4/h3H,1,4-5H2,2H3,(H,7,8);2*1-2H3.
What are the key properties of N-(2-methoxyethyl)prop-2-enamide;bis(propan-2-one)?
N-(2-methoxyethyl)prop-2-enamide;bis(propan-2-one) has a molecular weight of 245.32 g/mol, XLogP of 1.13, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-methoxyethyl)prop-2-enamide;bis(propan-2-one) is sourced from PubChem (CID 19756748), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).