About 1H-pyrazole-4,5-dicarboxylate
1H-pyrazole-4,5-dicarboxylate (PubChem CID 19757499) has the molecular formula C5H2N2O4-2
and a molecular weight of 154.08 g/mol. Its IUPAC name is 1H-pyrazole-4,5-dicarboxylate.
Molecular Properties
| Compound Name | 1H-pyrazole-4,5-dicarboxylate |
| PubChem CID | 19757499 |
| Molecular Formula | C5H2N2O4-2 |
| Molecular Weight | 154.08 g/mol |
| Exact Mass | 154.00 |
| IUPAC Name | 1H-pyrazole-4,5-dicarboxylate |
| SMILES | O=C([O-])c1cn[nH]c1C(=O)[O-] |
| InChI | InChI=1S/C5H4N2O4/c8-4(9)2-1-6-7-3(2)5(10)11/h1H,(H,6,7)(H,8,9)(H,10,11)/p-2 |
| InChIKey | IKTPUTARUKSCDG-UHFFFAOYSA-L |
| XLogP | -2.86 |
| TPSA | 108.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.08 |
| LogP ≤ 5 | -2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1H-pyrazole-4,5-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-pyrazole-4,5-dicarboxylate?
The IUPAC name of 1H-pyrazole-4,5-dicarboxylate (CID 19757499) is 1H-pyrazole-4,5-dicarboxylate.
What is the SMILES notation for 1H-pyrazole-4,5-dicarboxylate?
The canonical SMILES for 1H-pyrazole-4,5-dicarboxylate is O=C([O-])c1cn[nH]c1C(=O)[O-].
What is the InChIKey of 1H-pyrazole-4,5-dicarboxylate?
The InChIKey is IKTPUTARUKSCDG-UHFFFAOYSA-L. The full InChI is InChI=1S/C5H4N2O4/c8-4(9)2-1-6-7-3(2)5(10)11/h1H,(H,6,7)(H,8,9)(H,10,11)/p-2.
What are the key properties of 1H-pyrazole-4,5-dicarboxylate?
1H-pyrazole-4,5-dicarboxylate has a molecular weight of 154.08 g/mol, XLogP of -2.86, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-pyrazole-4,5-dicarboxylate is sourced from PubChem (CID 19757499), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).