C12H11N2O2- — CID 6957868
5-(2,4-dimethylphenyl)-1H-pyrazole-4-carboxylate (PubChem CID 6957868) has the molecular formula C12H11N2O2- and a molecular weight of 215.23 g/mol. Its IUPAC name is 5-(2,4-dimethylphenyl)-1H-pyrazole-4-carboxylate.
| Compound Name | 5-(2,4-dimethylphenyl)-1H-pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 6957868 |
| Molecular Formula | C12H11N2O2- |
| Molecular Weight | 215.23 g/mol |
| Exact Mass | 215.08 |
| IUPAC Name | 5-(2,4-dimethylphenyl)-1H-pyrazole-4-carboxylate |
| SMILES | Cc1ccc(-c2[nH]ncc2C(=O)[O-])c(C)c1 |
| InChI | InChI=1S/C12H12N2O2/c1-7-3-4-9(8(2)5-7)11-10(12(15)16)6-13-14-11/h3-6H,1-2H3,(H,13,14)(H,15,16)/p-1 |
| InChIKey | KGEQBBPEZHGSNN-UHFFFAOYSA-M |
| XLogP | 1.06 |
| TPSA | 68.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.23 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |