C17H14N2O2 — CID 135920556
[5-(2-hydroxy-5-methylphenyl)-1H-pyrazol-4-yl]-phenylmethanone (PubChem CID 135920556) has the molecular formula C17H14N2O2 and a molecular weight of 278.31 g/mol. Its IUPAC name is [5-(2-hydroxy-5-methylphenyl)-1H-pyrazol-4-yl]-phenylmethanone.
| Compound Name | [5-(2-hydroxy-5-methylphenyl)-1H-pyrazol-4-yl]-phenylmethanone |
|---|---|
| PubChem CID | 135920556 |
| Molecular Formula | C17H14N2O2 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | [5-(2-hydroxy-5-methylphenyl)-1H-pyrazol-4-yl]-phenylmethanone |
| SMILES | Cc1ccc(O)c(-c2[nH]ncc2C(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C17H14N2O2/c1-11-7-8-15(20)13(9-11)16-14(10-18-19-16)17(21)12-5-3-2-4-6-12/h2-10,20H,1H3,(H,18,19) |
| InChIKey | VJFLKKSEDWCOJY-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |