C10H7ClN2O4 — CID 135732771
5-(5-chloro-2,4-dihydroxyphenyl)-1H-pyrazole-4-carboxylic acid (PubChem CID 135732771) has the molecular formula C10H7ClN2O4 and a molecular weight of 254.63 g/mol. Its IUPAC name is 5-(5-chloro-2,4-dihydroxyphenyl)-1H-pyrazole-4-carboxylic acid.
| Compound Name | 5-(5-chloro-2,4-dihydroxyphenyl)-1H-pyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 135732771 |
| Molecular Formula | C10H7ClN2O4 |
| Molecular Weight | 254.63 g/mol |
| Exact Mass | 254.01 |
| IUPAC Name | 5-(5-chloro-2,4-dihydroxyphenyl)-1H-pyrazole-4-carboxylic acid |
| SMILES | O=C(O)c1cn[nH]c1-c1cc(Cl)c(O)cc1O |
| InChI | InChI=1S/C10H7ClN2O4/c11-6-1-4(7(14)2-8(6)15)9-5(10(16)17)3-12-13-9/h1-3,14-15H,(H,12,13)(H,16,17) |
| InChIKey | AEKRFDQDPGIZCK-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 106.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.63 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |