C19H29ClN4O4 — CID 142903302
5-(5-chloro-2,4-dihydroxyphenyl)-N-[3-[2-methoxyethyl(methyl)amino]propyl]-1H-pyrazole-4-carboxamide;ethane (PubChem CID 142903302) has the molecular formula C19H29ClN4O4 and a molecular weight of 412.92 g/mol. Its IUPAC name is 5-(5-chloro-2,4-dihydroxyphenyl)-N-[3-[2-methoxyethyl(methyl)amino]propyl]-1H-pyrazole-4-carboxamide;ethane.
| Compound Name | 5-(5-chloro-2,4-dihydroxyphenyl)-N-[3-[2-methoxyethyl(methyl)amino]propyl]-1H-pyrazole-4-carboxamide;ethane |
|---|---|
| PubChem CID | 142903302 |
| Molecular Formula | C19H29ClN4O4 |
| Molecular Weight | 412.92 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | 5-(5-chloro-2,4-dihydroxyphenyl)-N-[3-[2-methoxyethyl(methyl)amino]propyl]-1H-pyrazole-4-carboxamide;ethane |
| SMILES | CC.COCCN(C)CCCNC(=O)c1cn[nH]c1-c1cc(Cl)c(O)cc1O |
| InChI | InChI=1S/C17H23ClN4O4.C2H6/c1-22(6-7-26-2)5-3-4-19-17(25)12-10-20-21-16(12)11-8-13(18)15(24)9-14(11)23;1-2/h8-10,23-24H,3-7H2,1-2H3,(H,19,25)(H,20,21);1-2H3 |
| InChIKey | QVHLKRMFCVIGIM-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 110.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.92 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|