C18H23ClN2O4 — CID 70850461
5-(2,4-dibutoxy-5-chlorophenyl)-1H-pyrazole-4-carboxylic acid (PubChem CID 70850461) has the molecular formula C18H23ClN2O4 and a molecular weight of 366.85 g/mol. Its IUPAC name is 5-(2,4-dibutoxy-5-chlorophenyl)-1H-pyrazole-4-carboxylic acid.
| Compound Name | 5-(2,4-dibutoxy-5-chlorophenyl)-1H-pyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 70850461 |
| Molecular Formula | C18H23ClN2O4 |
| Molecular Weight | 366.85 g/mol |
| Exact Mass | 366.13 |
| IUPAC Name | 5-(2,4-dibutoxy-5-chlorophenyl)-1H-pyrazole-4-carboxylic acid |
| SMILES | CCCCOc1cc(OCCCC)c(-c2[nH]ncc2C(=O)O)cc1Cl |
| InChI | InChI=1S/C18H23ClN2O4/c1-3-5-7-24-15-10-16(25-8-6-4-2)14(19)9-12(15)17-13(18(22)23)11-20-21-17/h9-11H,3-8H2,1-2H3,(H,20,21)(H,22,23) |
| InChIKey | MSPQJKLLHZZHFN-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 84.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.85 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|