C22H30ClN3O5 — CID 71272950
4-acetamido-5-(2,4-dibutoxy-5-chlorophenyl)-N-ethyl-1,2-oxazole-3-carboxamide (PubChem CID 71272950) has the molecular formula C22H30ClN3O5 and a molecular weight of 451.95 g/mol. Its IUPAC name is 4-acetamido-5-(2,4-dibutoxy-5-chlorophenyl)-N-ethyl-1,2-oxazole-3-carboxamide.
| Compound Name | 4-acetamido-5-(2,4-dibutoxy-5-chlorophenyl)-N-ethyl-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 71272950 |
| Molecular Formula | C22H30ClN3O5 |
| Molecular Weight | 451.95 g/mol |
| Exact Mass | 451.19 |
| IUPAC Name | 4-acetamido-5-(2,4-dibutoxy-5-chlorophenyl)-N-ethyl-1,2-oxazole-3-carboxamide |
| SMILES | CCCCOc1cc(OCCCC)c(-c2onc(C(=O)NCC)c2NC(C)=O)cc1Cl |
| InChI | InChI=1S/C22H30ClN3O5/c1-5-8-10-29-17-13-18(30-11-9-6-2)16(23)12-15(17)21-19(25-14(4)27)20(26-31-21)22(28)24-7-3/h12-13H,5-11H2,1-4H3,(H,24,28)(H,25,27) |
| InChIKey | BCUITINFSNYQMG-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 102.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.95 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|