C27H33ClN2O5 — CID 70895951
5-(2,4-dibutoxy-5-chlorophenyl)-N-ethyl-4-(4-methoxyphenyl)-1,2-oxazole-3-carboxamide (PubChem CID 70895951) has the molecular formula C27H33ClN2O5 and a molecular weight of 501.02 g/mol. Its IUPAC name is 5-(2,4-dibutoxy-5-chlorophenyl)-N-ethyl-4-(4-methoxyphenyl)-1,2-oxazole-3-carboxamide.
| Compound Name | 5-(2,4-dibutoxy-5-chlorophenyl)-N-ethyl-4-(4-methoxyphenyl)-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 70895951 |
| Molecular Formula | C27H33ClN2O5 |
| Molecular Weight | 501.02 g/mol |
| Exact Mass | 500.21 |
| IUPAC Name | 5-(2,4-dibutoxy-5-chlorophenyl)-N-ethyl-4-(4-methoxyphenyl)-1,2-oxazole-3-carboxamide |
| SMILES | CCCCOc1cc(OCCCC)c(-c2onc(C(=O)NCC)c2-c2ccc(OC)cc2)cc1Cl |
| InChI | InChI=1S/C27H33ClN2O5/c1-5-8-14-33-22-17-23(34-15-9-6-2)21(28)16-20(22)26-24(18-10-12-19(32-4)13-11-18)25(30-35-26)27(31)29-7-3/h10-13,16-17H,5-9,14-15H2,1-4H3,(H,29,31) |
| InChIKey | UZSJQHQEPQEBSG-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 82.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.02 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|