C29H38ClN3O7 — CID 143645485
5-(5-chloro-2,4-dihydroxyphenyl)-N-ethyl-4-[4-(2,2,4,4-tetramethylhexoxy)phenyl]-1,2-oxazole-3-carboxamide;N-hydroxyformamide (PubChem CID 143645485) has the molecular formula C29H38ClN3O7 and a molecular weight of 576.09 g/mol. Its IUPAC name is 5-(5-chloro-2,4-dihydroxyphenyl)-N-ethyl-4-[4-(2,2,4,4-tetramethylhexoxy)phenyl]-1,2-oxazole-3-carboxamide;N-hydroxyformamide.
| Compound Name | 5-(5-chloro-2,4-dihydroxyphenyl)-N-ethyl-4-[4-(2,2,4,4-tetramethylhexoxy)phenyl]-1,2-oxazole-3-carboxamide;N-hydroxyformamide |
|---|---|
| PubChem CID | 143645485 |
| Molecular Formula | C29H38ClN3O7 |
| Molecular Weight | 576.09 g/mol |
| Exact Mass | 575.24 |
| IUPAC Name | 5-(5-chloro-2,4-dihydroxyphenyl)-N-ethyl-4-[4-(2,2,4,4-tetramethylhexoxy)phenyl]-1,2-oxazole-3-carboxamide;N-hydroxyformamide |
| SMILES | CCNC(=O)c1noc(-c2cc(Cl)c(O)cc2O)c1-c1ccc(OCC(C)(C)CC(C)(C)CC)cc1.O=CNO |
| InChI | InChI=1S/C28H35ClN2O5.CH3NO2/c1-7-27(3,4)15-28(5,6)16-35-18-11-9-17(10-12-18)23-24(26(34)30-8-2)31-36-25(23)19-13-20(29)22(33)14-21(19)32;3-1-2-4/h9-14,32-33H,7-8,15-16H2,1-6H3,(H,30,34);1,4H,(H,2,3) |
| InChIKey | IWQDWKMOCKWCKD-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 154.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.09 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|