C41H36N2O5 — CID 24773534
N-ethyl-4-(4-formylphenyl)-5-[5-(2-phenylethyl)-2,4-bis(phenylmethoxy)phenyl]-1,2-oxazole-3-carboxamide (PubChem CID 24773534) has the molecular formula C41H36N2O5 and a molecular weight of 636.75 g/mol. Its IUPAC name is N-ethyl-4-(4-formylphenyl)-5-[5-(2-phenylethyl)-2,4-bis(phenylmethoxy)phenyl]-1,2-oxazole-3-carboxamide.
| Compound Name | N-ethyl-4-(4-formylphenyl)-5-[5-(2-phenylethyl)-2,4-bis(phenylmethoxy)phenyl]-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 24773534 |
| Molecular Formula | C41H36N2O5 |
| Molecular Weight | 636.75 g/mol |
| Exact Mass | 636.26 |
| IUPAC Name | N-ethyl-4-(4-formylphenyl)-5-[5-(2-phenylethyl)-2,4-bis(phenylmethoxy)phenyl]-1,2-oxazole-3-carboxamide |
| SMILES | CCNC(=O)c1noc(-c2cc(CCc3ccccc3)c(OCc3ccccc3)cc2OCc2ccccc2)c1-c1ccc(C=O)cc1 |
| InChI | InChI=1S/C41H36N2O5/c1-2-42-41(45)39-38(33-21-19-30(26-44)20-22-33)40(48-43-39)35-24-34(23-18-29-12-6-3-7-13-29)36(46-27-31-14-8-4-9-15-31)25-37(35)47-28-32-16-10-5-11-17-32/h3-17,19-22,24-26H,2,18,23,27-28H2,1H3,(H,42,45) |
| InChIKey | OBIZPOIBEOEIAW-UHFFFAOYSA-N |
| XLogP | 8.51 |
| TPSA | 90.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.75 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|