C40H43N3O4 — CID 135265032
5-[2,4-bis(phenylmethoxy)-5-propan-2-ylphenyl]-N-ethyl-4-(3-methyl-1,2,4,5-tetrahydro-3-benzazepin-7-yl)-1,2-oxazole-3-carboxamide (PubChem CID 135265032) has the molecular formula C40H43N3O4 and a molecular weight of 629.80 g/mol. Its IUPAC name is 5-[2,4-bis(phenylmethoxy)-5-propan-2-ylphenyl]-N-ethyl-4-(3-methyl-1,2,4,5-tetrahydro-3-benzazepin-7-yl)-1,2-oxazole-3-carboxamide.
| Compound Name | 5-[2,4-bis(phenylmethoxy)-5-propan-2-ylphenyl]-N-ethyl-4-(3-methyl-1,2,4,5-tetrahydro-3-benzazepin-7-yl)-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 135265032 |
| Molecular Formula | C40H43N3O4 |
| Molecular Weight | 629.80 g/mol |
| Exact Mass | 629.33 |
| IUPAC Name | 5-[2,4-bis(phenylmethoxy)-5-propan-2-ylphenyl]-N-ethyl-4-(3-methyl-1,2,4,5-tetrahydro-3-benzazepin-7-yl)-1,2-oxazole-3-carboxamide |
| SMILES | CCNC(=O)c1noc(-c2cc(C(C)C)c(OCc3ccccc3)cc2OCc2ccccc2)c1-c1ccc2c(c1)CCN(C)CC2 |
| InChI | InChI=1S/C40H43N3O4/c1-5-41-40(44)38-37(32-17-16-30-18-20-43(4)21-19-31(30)22-32)39(47-42-38)34-23-33(27(2)3)35(45-25-28-12-8-6-9-13-28)24-36(34)46-26-29-14-10-7-11-15-29/h6-17,22-24,27H,5,18-21,25-26H2,1-4H3,(H,41,44) |
| InChIKey | SPJJBPVIDANBOD-UHFFFAOYSA-N |
| XLogP | 8.07 |
| TPSA | 76.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.80 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |