C31H34N4O3 — CID 134166486
N-ethyl-5-(4-methyl-2-phenylmethoxy-5-propan-2-ylphenyl)-4-(5,6,7,8-tetrahydro-1,6-naphthyridin-3-yl)-1,2-oxazole-3-carboxamide (PubChem CID 134166486) has the molecular formula C31H34N4O3 and a molecular weight of 510.64 g/mol. Its IUPAC name is N-ethyl-5-(4-methyl-2-phenylmethoxy-5-propan-2-ylphenyl)-4-(5,6,7,8-tetrahydro-1,6-naphthyridin-3-yl)-1,2-oxazole-3-carboxamide.
| Compound Name | N-ethyl-5-(4-methyl-2-phenylmethoxy-5-propan-2-ylphenyl)-4-(5,6,7,8-tetrahydro-1,6-naphthyridin-3-yl)-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 134166486 |
| Molecular Formula | C31H34N4O3 |
| Molecular Weight | 510.64 g/mol |
| Exact Mass | 510.26 |
| IUPAC Name | N-ethyl-5-(4-methyl-2-phenylmethoxy-5-propan-2-ylphenyl)-4-(5,6,7,8-tetrahydro-1,6-naphthyridin-3-yl)-1,2-oxazole-3-carboxamide |
| SMILES | CCNC(=O)c1noc(-c2cc(C(C)C)c(C)cc2OCc2ccccc2)c1-c1cnc2c(c1)CNCC2 |
| InChI | InChI=1S/C31H34N4O3/c1-5-33-31(36)29-28(23-14-22-16-32-12-11-26(22)34-17-23)30(38-35-29)25-15-24(19(2)3)20(4)13-27(25)37-18-21-9-7-6-8-10-21/h6-10,13-15,17,19,32H,5,11-12,16,18H2,1-4H3,(H,33,36) |
| InChIKey | IQSZYWLGSVJXOG-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 89.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.64 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |