C23H25IN2O3 — CID 134166507
N-ethyl-4-iodo-3-(4-methyl-2-phenylmethoxy-5-propan-2-ylphenyl)-1,2-oxazole-5-carboxamide (PubChem CID 134166507) has the molecular formula C23H25IN2O3 and a molecular weight of 504.37 g/mol. Its IUPAC name is N-ethyl-4-iodo-3-(4-methyl-2-phenylmethoxy-5-propan-2-ylphenyl)-1,2-oxazole-5-carboxamide.
| Compound Name | N-ethyl-4-iodo-3-(4-methyl-2-phenylmethoxy-5-propan-2-ylphenyl)-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 134166507 |
| Molecular Formula | C23H25IN2O3 |
| Molecular Weight | 504.37 g/mol |
| Exact Mass | 504.09 |
| IUPAC Name | N-ethyl-4-iodo-3-(4-methyl-2-phenylmethoxy-5-propan-2-ylphenyl)-1,2-oxazole-5-carboxamide |
| SMILES | CCNC(=O)c1onc(-c2cc(C(C)C)c(C)cc2OCc2ccccc2)c1I |
| InChI | InChI=1S/C23H25IN2O3/c1-5-25-23(27)22-20(24)21(26-29-22)18-12-17(14(2)3)15(4)11-19(18)28-13-16-9-7-6-8-10-16/h6-12,14H,5,13H2,1-4H3,(H,25,27) |
| InChIKey | KYVJESCRYKTYCN-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.37 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|