About 3-(2,4-dibutoxy-5-propan-2-ylphenyl)-4-iodo-1,2-oxazole-5-carbonyl chloride
3-(2,4-dibutoxy-5-propan-2-ylphenyl)-4-iodo-1,2-oxazole-5-carbonyl chloride (PubChem CID 122430004) has the molecular formula C21H27ClINO4
and a molecular weight of 519.81 g/mol. Its IUPAC name is 3-(2,4-dibutoxy-5-propan-2-ylphenyl)-4-iodo-1,2-oxazole-5-carbonyl chloride.
Molecular Properties
| Compound Name | 3-(2,4-dibutoxy-5-propan-2-ylphenyl)-4-iodo-1,2-oxazole-5-carbonyl chloride |
| PubChem CID | 122430004 |
| Molecular Formula | C21H27ClINO4 |
| Molecular Weight | 519.81 g/mol |
| Exact Mass | 519.07 |
| IUPAC Name | 3-(2,4-dibutoxy-5-propan-2-ylphenyl)-4-iodo-1,2-oxazole-5-carbonyl chloride |
| SMILES | CCCCOc1cc(OCCCC)c(C(C)C)cc1-c1noc(C(=O)Cl)c1I |
| InChI | InChI=1S/C21H27ClINO4/c1-5-7-9-26-16-12-17(27-10-8-6-2)15(11-14(16)13(3)4)19-18(23)20(21(22)25)28-24-19/h11-13H,5-10H2,1-4H3 |
| InChIKey | LDFKEUDVAKILGN-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 519.81 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-(2,4-dibutoxy-5-propan-2-ylphenyl)-4-iodo-1,2-oxazole-5-carbonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,4-dibutoxy-5-propan-2-ylphenyl)-4-iodo-1,2-oxazole-5-carbonyl chloride?
The IUPAC name of 3-(2,4-dibutoxy-5-propan-2-ylphenyl)-4-iodo-1,2-oxazole-5-carbonyl chloride (CID 122430004) is 3-(2,4-dibutoxy-5-propan-2-ylphenyl)-4-iodo-1,2-oxazole-5-carbonyl chloride.
What is the SMILES notation for 3-(2,4-dibutoxy-5-propan-2-ylphenyl)-4-iodo-1,2-oxazole-5-carbonyl chloride?
The canonical SMILES for 3-(2,4-dibutoxy-5-propan-2-ylphenyl)-4-iodo-1,2-oxazole-5-carbonyl chloride is CCCCOc1cc(OCCCC)c(C(C)C)cc1-c1noc(C(=O)Cl)c1I.
What is the InChIKey of 3-(2,4-dibutoxy-5-propan-2-ylphenyl)-4-iodo-1,2-oxazole-5-carbonyl chloride?
The InChIKey is LDFKEUDVAKILGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H27ClINO4/c1-5-7-9-26-16-12-17(27-10-8-6-2)15(11-14(16)13(3)4)19-18(23)20(21(22)25)28-24-19/h11-13H,5-10H2,1-4H3.
What are the key properties of 3-(2,4-dibutoxy-5-propan-2-ylphenyl)-4-iodo-1,2-oxazole-5-carbonyl chloride?
3-(2,4-dibutoxy-5-propan-2-ylphenyl)-4-iodo-1,2-oxazole-5-carbonyl chloride has a molecular weight of 519.81 g/mol, XLogP of 6.81, 11 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,4-dibutoxy-5-propan-2-ylphenyl)-4-iodo-1,2-oxazole-5-carbonyl chloride is sourced from PubChem (CID 122430004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).