C29H39N3O7 — CID 71110462
ethyl 4-[3-(acetamidomethyl)-1,2-oxazol-5-yl]-5-(2,4-dibutoxy-5-propan-2-ylphenyl)-1,2-oxazole-3-carboxylate (PubChem CID 71110462) has the molecular formula C29H39N3O7 and a molecular weight of 541.65 g/mol. Its IUPAC name is ethyl 4-[3-(acetamidomethyl)-1,2-oxazol-5-yl]-5-(2,4-dibutoxy-5-propan-2-ylphenyl)-1,2-oxazole-3-carboxylate.
| Compound Name | ethyl 4-[3-(acetamidomethyl)-1,2-oxazol-5-yl]-5-(2,4-dibutoxy-5-propan-2-ylphenyl)-1,2-oxazole-3-carboxylate |
|---|---|
| PubChem CID | 71110462 |
| Molecular Formula | C29H39N3O7 |
| Molecular Weight | 541.65 g/mol |
| Exact Mass | 541.28 |
| IUPAC Name | ethyl 4-[3-(acetamidomethyl)-1,2-oxazol-5-yl]-5-(2,4-dibutoxy-5-propan-2-ylphenyl)-1,2-oxazole-3-carboxylate |
| SMILES | CCCCOc1cc(OCCCC)c(C(C)C)cc1-c1onc(C(=O)OCC)c1-c1cc(CNC(C)=O)no1 |
| InChI | InChI=1S/C29H39N3O7/c1-7-10-12-36-23-16-24(37-13-11-8-2)22(15-21(23)18(4)5)28-26(27(32-39-28)29(34)35-9-3)25-14-20(31-38-25)17-30-19(6)33/h14-16,18H,7-13,17H2,1-6H3,(H,30,33) |
| InChIKey | NAAMFHBMKFUJEF-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 125.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.65 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|