C23H33IN2O5 — CID 122430487
3-(2,4-dibutoxy-5-propan-2-ylphenyl)-N-(2-hydroxyethyl)-4-iodo-1,2-oxazole-5-carboxamide (PubChem CID 122430487) has the molecular formula C23H33IN2O5 and a molecular weight of 544.43 g/mol. Its IUPAC name is 3-(2,4-dibutoxy-5-propan-2-ylphenyl)-N-(2-hydroxyethyl)-4-iodo-1,2-oxazole-5-carboxamide.
| Compound Name | 3-(2,4-dibutoxy-5-propan-2-ylphenyl)-N-(2-hydroxyethyl)-4-iodo-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 122430487 |
| Molecular Formula | C23H33IN2O5 |
| Molecular Weight | 544.43 g/mol |
| Exact Mass | 544.14 |
| IUPAC Name | 3-(2,4-dibutoxy-5-propan-2-ylphenyl)-N-(2-hydroxyethyl)-4-iodo-1,2-oxazole-5-carboxamide |
| SMILES | CCCCOc1cc(OCCCC)c(C(C)C)cc1-c1noc(C(=O)NCCO)c1I |
| InChI | InChI=1S/C23H33IN2O5/c1-5-7-11-29-18-14-19(30-12-8-6-2)17(13-16(18)15(3)4)21-20(24)22(31-26-21)23(28)25-9-10-27/h13-15,27H,5-12H2,1-4H3,(H,25,28) |
| InChIKey | SIJWMJNOBCPHPH-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 93.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.43 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|