C24H28ClFN2O3 — CID 70811258
[5-(2,4-dibutoxy-5-chlorophenyl)-4-(4-fluorophenyl)-1,2-oxazol-3-yl]methanamine (PubChem CID 70811258) has the molecular formula C24H28ClFN2O3 and a molecular weight of 446.95 g/mol. Its IUPAC name is [5-(2,4-dibutoxy-5-chlorophenyl)-4-(4-fluorophenyl)-1,2-oxazol-3-yl]methanamine.
| Compound Name | [5-(2,4-dibutoxy-5-chlorophenyl)-4-(4-fluorophenyl)-1,2-oxazol-3-yl]methanamine |
|---|---|
| PubChem CID | 70811258 |
| Molecular Formula | C24H28ClFN2O3 |
| Molecular Weight | 446.95 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | [5-(2,4-dibutoxy-5-chlorophenyl)-4-(4-fluorophenyl)-1,2-oxazol-3-yl]methanamine |
| SMILES | CCCCOc1cc(OCCCC)c(-c2onc(CN)c2-c2ccc(F)cc2)cc1Cl |
| InChI | InChI=1S/C24H28ClFN2O3/c1-3-5-11-29-21-14-22(30-12-6-4-2)19(25)13-18(21)24-23(20(15-27)28-31-24)16-7-9-17(26)10-8-16/h7-10,13-14H,3-6,11-12,15,27H2,1-2H3 |
| InChIKey | XNQNAHXZUVVJCO-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 70.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.95 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|