C14H19ClN2O2S — CID 142871887
4-butoxy-3-chlorobenzenethiol;5-methyl-1,2-oxazol-3-amine (PubChem CID 142871887) has the molecular formula C14H19ClN2O2S and a molecular weight of 314.84 g/mol. Its IUPAC name is 4-butoxy-3-chlorobenzenethiol;5-methyl-1,2-oxazol-3-amine.
| Compound Name | 4-butoxy-3-chlorobenzenethiol;5-methyl-1,2-oxazol-3-amine |
|---|---|
| PubChem CID | 142871887 |
| Molecular Formula | C14H19ClN2O2S |
| Molecular Weight | 314.84 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | 4-butoxy-3-chlorobenzenethiol;5-methyl-1,2-oxazol-3-amine |
| SMILES | CCCCOc1ccc(S)cc1Cl.Cc1cc(N)no1 |
| InChI | InChI=1S/C10H13ClOS.C4H6N2O/c1-2-3-6-12-10-5-4-8(13)7-9(10)11;1-3-2-4(5)6-7-3/h4-5,7,13H,2-3,6H2,1H3;2H,1H3,(H2,5,6) |
| InChIKey | NXIKNJAUBLWBNF-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.84 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|