C20H22FNO — CID 155125249
3-butyl-1-(4-fluorophenyl)-6-methoxy-3,4-dihydroisoquinoline (PubChem CID 155125249) has the molecular formula C20H22FNO and a molecular weight of 311.40 g/mol. Its IUPAC name is 3-butyl-1-(4-fluorophenyl)-6-methoxy-3,4-dihydroisoquinoline.
| Compound Name | 3-butyl-1-(4-fluorophenyl)-6-methoxy-3,4-dihydroisoquinoline |
|---|---|
| PubChem CID | 155125249 |
| Molecular Formula | C20H22FNO |
| Molecular Weight | 311.40 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | 3-butyl-1-(4-fluorophenyl)-6-methoxy-3,4-dihydroisoquinoline |
| SMILES | CCCCC1Cc2cc(OC)ccc2C(c2ccc(F)cc2)=N1 |
| InChI | InChI=1S/C20H22FNO/c1-3-4-5-17-12-15-13-18(23-2)10-11-19(15)20(22-17)14-6-8-16(21)9-7-14/h6-11,13,17H,3-5,12H2,1-2H3 |
| InChIKey | HTHLYBKNGLXZGB-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.40 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |