C25H21ClN2O3 — CID 58879171
1-[5-[5-chloro-2,4-bis(phenylmethoxy)phenyl]-1H-pyrazol-4-yl]ethanone (PubChem CID 58879171) has the molecular formula C25H21ClN2O3 and a molecular weight of 432.91 g/mol. Its IUPAC name is 1-[5-[5-chloro-2,4-bis(phenylmethoxy)phenyl]-1H-pyrazol-4-yl]ethanone.
| Compound Name | 1-[5-[5-chloro-2,4-bis(phenylmethoxy)phenyl]-1H-pyrazol-4-yl]ethanone |
|---|---|
| PubChem CID | 58879171 |
| Molecular Formula | C25H21ClN2O3 |
| Molecular Weight | 432.91 g/mol |
| Exact Mass | 432.12 |
| IUPAC Name | 1-[5-[5-chloro-2,4-bis(phenylmethoxy)phenyl]-1H-pyrazol-4-yl]ethanone |
| SMILES | CC(=O)c1cn[nH]c1-c1cc(Cl)c(OCc2ccccc2)cc1OCc1ccccc1 |
| InChI | InChI=1S/C25H21ClN2O3/c1-17(29)21-14-27-28-25(21)20-12-22(26)24(31-16-19-10-6-3-7-11-19)13-23(20)30-15-18-8-4-2-5-9-18/h2-14H,15-16H2,1H3,(H,27,28) |
| InChIKey | ZGEMQQLLQSBHSZ-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 64.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.91 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |