C24H17ClINO5 — CID 142773781
5-[5-chloro-2,4-bis(phenylmethoxy)phenyl]-4-iodo-1,2-oxazole-3-carboxylic acid (PubChem CID 142773781) has the molecular formula C24H17ClINO5 and a molecular weight of 561.76 g/mol. Its IUPAC name is 5-[5-chloro-2,4-bis(phenylmethoxy)phenyl]-4-iodo-1,2-oxazole-3-carboxylic acid.
| Compound Name | 5-[5-chloro-2,4-bis(phenylmethoxy)phenyl]-4-iodo-1,2-oxazole-3-carboxylic acid |
|---|---|
| PubChem CID | 142773781 |
| Molecular Formula | C24H17ClINO5 |
| Molecular Weight | 561.76 g/mol |
| Exact Mass | 560.98 |
| IUPAC Name | 5-[5-chloro-2,4-bis(phenylmethoxy)phenyl]-4-iodo-1,2-oxazole-3-carboxylic acid |
| SMILES | O=C(O)c1noc(-c2cc(Cl)c(OCc3ccccc3)cc2OCc2ccccc2)c1I |
| InChI | InChI=1S/C24H17ClINO5/c25-18-11-17(23-21(26)22(24(28)29)27-32-23)19(30-13-15-7-3-1-4-8-15)12-20(18)31-14-16-9-5-2-6-10-16/h1-12H,13-14H2,(H,28,29) |
| InChIKey | KAULAFGVRNUWKX-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 81.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.76 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|