C25H20ClNO3 — CID 88981237
3-[5-(5-chloro-4-methyl-2-phenylmethoxyphenyl)-3-methyl-1,2-oxazol-4-yl]benzaldehyde (PubChem CID 88981237) has the molecular formula C25H20ClNO3 and a molecular weight of 417.89 g/mol. Its IUPAC name is 3-[5-(5-chloro-4-methyl-2-phenylmethoxyphenyl)-3-methyl-1,2-oxazol-4-yl]benzaldehyde.
| Compound Name | 3-[5-(5-chloro-4-methyl-2-phenylmethoxyphenyl)-3-methyl-1,2-oxazol-4-yl]benzaldehyde |
|---|---|
| PubChem CID | 88981237 |
| Molecular Formula | C25H20ClNO3 |
| Molecular Weight | 417.89 g/mol |
| Exact Mass | 417.11 |
| IUPAC Name | 3-[5-(5-chloro-4-methyl-2-phenylmethoxyphenyl)-3-methyl-1,2-oxazol-4-yl]benzaldehyde |
| SMILES | Cc1cc(OCc2ccccc2)c(-c2onc(C)c2-c2cccc(C=O)c2)cc1Cl |
| InChI | InChI=1S/C25H20ClNO3/c1-16-11-23(29-15-18-7-4-3-5-8-18)21(13-22(16)26)25-24(17(2)27-30-25)20-10-6-9-19(12-20)14-28/h3-14H,15H2,1-2H3 |
| InChIKey | HDTTWPMPLJEENK-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.89 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|