C32H39ClN2O4Si — CID 90872761
1-[5-[5-chloro-2,4-bis(phenylmethoxy)phenyl]-1H-pyrazol-4-yl]ethanone;2-ethoxyethyl(trimethyl)silane (PubChem CID 90872761) has the molecular formula C32H39ClN2O4Si and a molecular weight of 579.21 g/mol. Its IUPAC name is 1-[5-[5-chloro-2,4-bis(phenylmethoxy)phenyl]-1H-pyrazol-4-yl]ethanone;2-ethoxyethyl(trimethyl)silane.
| Compound Name | 1-[5-[5-chloro-2,4-bis(phenylmethoxy)phenyl]-1H-pyrazol-4-yl]ethanone;2-ethoxyethyl(trimethyl)silane |
|---|---|
| PubChem CID | 90872761 |
| Molecular Formula | C32H39ClN2O4Si |
| Molecular Weight | 579.21 g/mol |
| Exact Mass | 578.24 |
| IUPAC Name | 1-[5-[5-chloro-2,4-bis(phenylmethoxy)phenyl]-1H-pyrazol-4-yl]ethanone;2-ethoxyethyl(trimethyl)silane |
| SMILES | CC(=O)c1cn[nH]c1-c1cc(Cl)c(OCc2ccccc2)cc1OCc1ccccc1.CCOCC[Si](C)(C)C |
| InChI | InChI=1S/C25H21ClN2O3.C7H18OSi/c1-17(29)21-14-27-28-25(21)20-12-22(26)24(31-16-19-10-6-3-7-11-19)13-23(20)30-15-18-8-4-2-5-9-18;1-5-8-6-7-9(2,3)4/h2-14H,15-16H2,1H3,(H,27,28);5-7H2,1-4H3 |
| InChIKey | ARHBSWHFZOYEQQ-UHFFFAOYSA-N |
| XLogP | 8.45 |
| TPSA | 73.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.21 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|