C19H24N2O — CID 19761201
N-[1-(7-bicyclo[4.2.0]octa-1,3,5,7-tetraenylmethyl)piperidin-4-yl]-N,2-dimethylprop-2-enamide (PubChem CID 19761201) has the molecular formula C19H24N2O and a molecular weight of 296.41 g/mol. Its IUPAC name is N-[1-(7-bicyclo[4.2.0]octa-1,3,5,7-tetraenylmethyl)piperidin-4-yl]-N,2-dimethylprop-2-enamide.
| Compound Name | N-[1-(7-bicyclo[4.2.0]octa-1,3,5,7-tetraenylmethyl)piperidin-4-yl]-N,2-dimethylprop-2-enamide |
|---|---|
| PubChem CID | 19761201 |
| Molecular Formula | C19H24N2O |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.19 |
| IUPAC Name | N-[1-(7-bicyclo[4.2.0]octa-1,3,5,7-tetraenylmethyl)piperidin-4-yl]-N,2-dimethylprop-2-enamide |
| SMILES | C=C(C)C(=O)N(C)C1CCN(CC2=Cc3ccccc32)CC1 |
| InChI | InChI=1S/C19H24N2O/c1-14(2)19(22)20(3)17-8-10-21(11-9-17)13-16-12-15-6-4-5-7-18(15)16/h4-7,12,17H,1,8-11,13H2,2-3H3 |
| InChIKey | KXZNCPMNFZMLIA-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|