C19H21N3O4 — CID 19761843
2-[carbamoyl(hydroxy)amino]-N-[(E)-4-(3-phenoxyphenyl)but-3-en-2-yl]acetamide (PubChem CID 19761843) has the molecular formula C19H21N3O4 and a molecular weight of 355.39 g/mol. Its IUPAC name is 2-[carbamoyl(hydroxy)amino]-N-[(E)-4-(3-phenoxyphenyl)but-3-en-2-yl]acetamide.
| Compound Name | 2-[carbamoyl(hydroxy)amino]-N-[(E)-4-(3-phenoxyphenyl)but-3-en-2-yl]acetamide |
|---|---|
| PubChem CID | 19761843 |
| Molecular Formula | C19H21N3O4 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | 2-[carbamoyl(hydroxy)amino]-N-[(E)-4-(3-phenoxyphenyl)but-3-en-2-yl]acetamide |
| SMILES | CC(/C=C/c1cccc(Oc2ccccc2)c1)NC(=O)CN(O)C(N)=O |
| InChI | InChI=1S/C19H21N3O4/c1-14(21-18(23)13-22(25)19(20)24)10-11-15-6-5-9-17(12-15)26-16-7-3-2-4-8-16/h2-12,14,25H,13H2,1H3,(H2,20,24)(H,21,23)/b11-10+ |
| InChIKey | IXJQAGHSFSMLQC-ZHACJKMWSA-N |
| XLogP | 2.77 |
| TPSA | 104.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|