C10H13F10N — CID 19761945
1,1,2,3,3,4,4,5,5,5-decafluoro-2-methyl-N-(2-methylpropyl)pentan-1-amine (PubChem CID 19761945) has the molecular formula C10H13F10N and a molecular weight of 337.20 g/mol. Its IUPAC name is 1,1,2,3,3,4,4,5,5,5-decafluoro-2-methyl-N-(2-methylpropyl)pentan-1-amine.
| Compound Name | 1,1,2,3,3,4,4,5,5,5-decafluoro-2-methyl-N-(2-methylpropyl)pentan-1-amine |
|---|---|
| PubChem CID | 19761945 |
| Molecular Formula | C10H13F10N |
| Molecular Weight | 337.20 g/mol |
| Exact Mass | 337.09 |
| IUPAC Name | 1,1,2,3,3,4,4,5,5,5-decafluoro-2-methyl-N-(2-methylpropyl)pentan-1-amine |
| SMILES | CC(C)CNC(F)(F)C(C)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H13F10N/c1-5(2)4-21-10(19,20)6(3,11)7(12,13)8(14,15)9(16,17)18/h5,21H,4H2,1-3H3 |
| InChIKey | INCUHHAPNHXKHH-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.20 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|