C28H41F2N — CID 19762045
2,3-difluoro-4-[4-[1-(4-heptylcyclohexyl)ethyl]cyclohexyl]benzonitrile (PubChem CID 19762045) has the molecular formula C28H41F2N and a molecular weight of 429.64 g/mol. Its IUPAC name is 2,3-difluoro-4-[4-[1-(4-heptylcyclohexyl)ethyl]cyclohexyl]benzonitrile.
| Compound Name | 2,3-difluoro-4-[4-[1-(4-heptylcyclohexyl)ethyl]cyclohexyl]benzonitrile |
|---|---|
| PubChem CID | 19762045 |
| Molecular Formula | C28H41F2N |
| Molecular Weight | 429.64 g/mol |
| Exact Mass | 429.32 |
| IUPAC Name | 2,3-difluoro-4-[4-[1-(4-heptylcyclohexyl)ethyl]cyclohexyl]benzonitrile |
| SMILES | CCCCCCCC1CCC(C(C)C2CCC(c3ccc(C#N)c(F)c3F)CC2)CC1 |
| InChI | InChI=1S/C28H41F2N/c1-3-4-5-6-7-8-21-9-11-22(12-10-21)20(2)23-13-15-24(16-14-23)26-18-17-25(19-31)27(29)28(26)30/h17-18,20-24H,3-16H2,1-2H3 |
| InChIKey | SSRCWXXNUIDFPE-UHFFFAOYSA-N |
| XLogP | 8.91 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.64 |
| LogP ≤ 5 | 8.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|