C18H16F4N2O5S — CID 19763992
3-[[4-[[4-fluoro-3-(trifluoromethyl)phenyl]sulfamoylmethyl]benzoyl]amino]propanoic acid (PubChem CID 19763992) has the molecular formula C18H16F4N2O5S and a molecular weight of 448.39 g/mol. Its IUPAC name is 3-[[4-[[4-fluoro-3-(trifluoromethyl)phenyl]sulfamoylmethyl]benzoyl]amino]propanoic acid.
| Compound Name | 3-[[4-[[4-fluoro-3-(trifluoromethyl)phenyl]sulfamoylmethyl]benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 19763992 |
| Molecular Formula | C18H16F4N2O5S |
| Molecular Weight | 448.39 g/mol |
| Exact Mass | 448.07 |
| IUPAC Name | 3-[[4-[[4-fluoro-3-(trifluoromethyl)phenyl]sulfamoylmethyl]benzoyl]amino]propanoic acid |
| SMILES | O=C(O)CCNC(=O)c1ccc(CS(=O)(=O)Nc2ccc(F)c(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C18H16F4N2O5S/c19-15-6-5-13(9-14(15)18(20,21)22)24-30(28,29)10-11-1-3-12(4-2-11)17(27)23-8-7-16(25)26/h1-6,9,24H,7-8,10H2,(H,23,27)(H,25,26) |
| InChIKey | CZAGAZZCHRUUNX-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.39 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |